Ads by Google
Large circular clean bucket, sweet design, convenient coattails, high durability the bright, warm, elegant, fashionable, generous, small and exquisite, structure, match with bright color, give a person with intense visual enjoyment modernist fashion, especially suitable for office, home etc humanitarian breath occasion. .
Item No.:XQ-2014 | |
Name:Reverse Side Clean Bucket | |
Meterial:PP | |
Weight:197g | |
Specification:24*25.5cm | |
Packing:OPP | |
Ctn/Qty:100PCS | |
Ctn/Size:68*40*47cm | |
G.W.:8Kg | |
N.W.:7Kg | |
MOQ:2000PCS | |
FOB(Ningbo)Price:$0.96PCS |